C31H29N3O3S — CID 10007007
N-[4-[2-[methyl-[(4-methylsulfanylphenyl)methyl]amino]ethoxy]phenyl]-9-oxo-10H-acridine-4-carboxamide (PubChem CID 10007007) has the molecular formula C31H29N3O3S and a molecular weight of 523.66 g/mol. Its IUPAC name is N-[4-[2-[methyl-[(4-methylsulfanylphenyl)methyl]amino]ethoxy]phenyl]-9-oxo-10H-acridine-4-carboxamide.
| Compound Name | N-[4-[2-[methyl-[(4-methylsulfanylphenyl)methyl]amino]ethoxy]phenyl]-9-oxo-10H-acridine-4-carboxamide |
|---|---|
| PubChem CID | 10007007 |
| Molecular Formula | C31H29N3O3S |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | N-[4-[2-[methyl-[(4-methylsulfanylphenyl)methyl]amino]ethoxy]phenyl]-9-oxo-10H-acridine-4-carboxamide |
| SMILES | CSc1ccc(CN(C)CCOc2ccc(NC(=O)c3cccc4c(=O)c5ccccc5[nH]c34)cc2)cc1 |
| InChI | InChI=1S/C31H29N3O3S/c1-34(20-21-10-16-24(38-2)17-11-21)18-19-37-23-14-12-22(13-15-23)32-31(36)27-8-5-7-26-29(27)33-28-9-4-3-6-25(28)30(26)35/h3-17H,18-20H2,1-2H3,(H,32,36)(H,33,35) |
| InChIKey | LIHUGDILVPBPNK-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|