C32H31N3O5 — CID 10052927
N-[4-[2-[(3,4-dimethoxyphenyl)methyl-methylamino]ethoxy]phenyl]-9-oxo-10H-acridine-4-carboxamide (PubChem CID 10052927) has the molecular formula C32H31N3O5 and a molecular weight of 537.62 g/mol. Its IUPAC name is N-[4-[2-[(3,4-dimethoxyphenyl)methyl-methylamino]ethoxy]phenyl]-9-oxo-10H-acridine-4-carboxamide.
| Compound Name | N-[4-[2-[(3,4-dimethoxyphenyl)methyl-methylamino]ethoxy]phenyl]-9-oxo-10H-acridine-4-carboxamide |
|---|---|
| PubChem CID | 10052927 |
| Molecular Formula | C32H31N3O5 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | N-[4-[2-[(3,4-dimethoxyphenyl)methyl-methylamino]ethoxy]phenyl]-9-oxo-10H-acridine-4-carboxamide |
| SMILES | COc1ccc(CN(C)CCOc2ccc(NC(=O)c3cccc4c(=O)c5ccccc5[nH]c34)cc2)cc1OC |
| InChI | InChI=1S/C32H31N3O5/c1-35(20-21-11-16-28(38-2)29(19-21)39-3)17-18-40-23-14-12-22(13-15-23)33-32(37)26-9-6-8-25-30(26)34-27-10-5-4-7-24(27)31(25)36/h4-16,19H,17-18,20H2,1-3H3,(H,33,37)(H,34,36) |
| InChIKey | BJRLHOPOAYFBCU-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|