C26H31N3O8S — CID 10007591
(E)-2-[(2S)-2-[[(2S)-2-(morpholine-4-carbonylamino)-3-phenylpropanoyl]amino]-4-phenylbutanoyl]oxyethenesulfonic acid (PubChem CID 10007591) has the molecular formula C26H31N3O8S and a molecular weight of 545.61 g/mol. Its IUPAC name is (E)-2-[(2S)-2-[[(2S)-2-(morpholine-4-carbonylamino)-3-phenylpropanoyl]amino]-4-phenylbutanoyl]oxyethenesulfonic acid.
| Compound Name | (E)-2-[(2S)-2-[[(2S)-2-(morpholine-4-carbonylamino)-3-phenylpropanoyl]amino]-4-phenylbutanoyl]oxyethenesulfonic acid |
|---|---|
| PubChem CID | 10007591 |
| Molecular Formula | C26H31N3O8S |
| Molecular Weight | 545.61 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | (E)-2-[(2S)-2-[[(2S)-2-(morpholine-4-carbonylamino)-3-phenylpropanoyl]amino]-4-phenylbutanoyl]oxyethenesulfonic acid |
| SMILES | O=C(N[C@@H](CCc1ccccc1)C(=O)O/C=C/S(=O)(=O)O)[C@H](Cc1ccccc1)NC(=O)N1CCOCC1 |
| InChI | InChI=1S/C26H31N3O8S/c30-24(23(19-21-9-5-2-6-10-21)28-26(32)29-13-15-36-16-14-29)27-22(12-11-20-7-3-1-4-8-20)25(31)37-17-18-38(33,34)35/h1-10,17-18,22-23H,11-16,19H2,(H,27,30)(H,28,32)(H,33,34,35)/b18-17+/t22-,23-/m0/s1 |
| InChIKey | AESUUKQLRQLZCP-ZRPIXQTESA-N |
| XLogP | 1.66 |
| TPSA | 151.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.61 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|