C25H32ClN3O5S — CID 67663447
N-[1-[[(2S)-1-(chloromethylsulfonyl)-4-phenylbutan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]morpholine-4-carboxamide (PubChem CID 67663447) has the molecular formula C25H32ClN3O5S and a molecular weight of 522.07 g/mol. Its IUPAC name is N-[1-[[(2S)-1-(chloromethylsulfonyl)-4-phenylbutan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]morpholine-4-carboxamide.
| Compound Name | N-[1-[[(2S)-1-(chloromethylsulfonyl)-4-phenylbutan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 67663447 |
| Molecular Formula | C25H32ClN3O5S |
| Molecular Weight | 522.07 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | N-[1-[[(2S)-1-(chloromethylsulfonyl)-4-phenylbutan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]morpholine-4-carboxamide |
| SMILES | O=C(N[C@@H](CCc1ccccc1)CS(=O)(=O)CCl)C(Cc1ccccc1)NC(=O)N1CCOCC1 |
| InChI | InChI=1S/C25H32ClN3O5S/c26-19-35(32,33)18-22(12-11-20-7-3-1-4-8-20)27-24(30)23(17-21-9-5-2-6-10-21)28-25(31)29-13-15-34-16-14-29/h1-10,22-23H,11-19H2,(H,27,30)(H,28,31)/t22-,23?/m0/s1 |
| InChIKey | GZOVJHZXRYOKFO-NQCNTLBGSA-N |
| XLogP | 2.37 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.07 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|