C40H58O3 — CID 10008522
[(1S,3R,6S,12S,16R)-7,7,12,16-tetramethyl-15-(6-methyl-5-methylideneheptan-2-yl)-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] (Z)-3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 10008522) has the molecular formula C40H58O3 and a molecular weight of 586.90 g/mol. Its IUPAC name is [(1S,3R,6S,12S,16R)-7,7,12,16-tetramethyl-15-(6-methyl-5-methylideneheptan-2-yl)-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] (Z)-3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [(1S,3R,6S,12S,16R)-7,7,12,16-tetramethyl-15-(6-methyl-5-methylideneheptan-2-yl)-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] (Z)-3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 10008522 |
| Molecular Formula | C40H58O3 |
| Molecular Weight | 586.90 g/mol |
| Exact Mass | 586.44 |
| IUPAC Name | [(1S,3R,6S,12S,16R)-7,7,12,16-tetramethyl-15-(6-methyl-5-methylideneheptan-2-yl)-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] (Z)-3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | C=C(CCC(C)C1CC[C@@]2(C)C3CCC4C(C)(C)[C@@H](OC(=O)/C=C\c5ccc(O)cc5)CC[C@@]45C[C@@]35CC[C@]12C)C(C)C |
| InChI | InChI=1S/C40H58O3/c1-26(2)27(3)9-10-28(4)31-19-21-38(8)33-17-16-32-36(5,6)34(43-35(42)18-13-29-11-14-30(41)15-12-29)20-22-39(32)25-40(33,39)24-23-37(31,38)7/h11-15,18,26,28,31-34,41H,3,9-10,16-17,19-25H2,1-2,4-8H3/b18-13-/t28?,31?,32?,33?,34-,37+,38-,39+,40-/m0/s1 |
| InChIKey | NWCFXEYHLYCCTG-GKYKSKKJSA-N |
| XLogP | 10.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.90 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|