C42H62O4 — CID 58289282
[7,7,12,16-tetramethyl-15-(6-methylhept-5-en-2-yl)-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] (E)-3-[4-ethoxy-3-(hydroxymethyl)phenyl]prop-2-enoate (PubChem CID 58289282) has the molecular formula C42H62O4 and a molecular weight of 630.95 g/mol. Its IUPAC name is [7,7,12,16-tetramethyl-15-(6-methylhept-5-en-2-yl)-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] (E)-3-[4-ethoxy-3-(hydroxymethyl)phenyl]prop-2-enoate.
| Compound Name | [7,7,12,16-tetramethyl-15-(6-methylhept-5-en-2-yl)-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] (E)-3-[4-ethoxy-3-(hydroxymethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 58289282 |
| Molecular Formula | C42H62O4 |
| Molecular Weight | 630.95 g/mol |
| Exact Mass | 630.46 |
| IUPAC Name | [7,7,12,16-tetramethyl-15-(6-methylhept-5-en-2-yl)-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] (E)-3-[4-ethoxy-3-(hydroxymethyl)phenyl]prop-2-enoate |
| SMILES | CCOc1ccc(/C=C/C(=O)OC2CCC34CC35CCC3(C)C(C(C)CCC=C(C)C)CCC3(C)C5CCC4C2(C)C)cc1CO |
| InChI | InChI=1S/C42H62O4/c1-9-45-33-15-13-30(25-31(33)26-43)14-18-37(44)46-36-20-22-41-27-42(41)24-23-39(7)32(29(4)12-10-11-28(2)3)19-21-40(39,8)35(42)17-16-34(41)38(36,5)6/h11,13-15,18,25,29,32,34-36,43H,9-10,12,16-17,19-24,26-27H2,1-8H3/b18-14+ |
| InChIKey | DSSLZUZOKNJGHE-NBVRZTHBSA-N |
| XLogP | 10.32 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.95 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|