C27H33ClN6O7 — CID 10008563
(2S)-2-[[(2R)-2-[[(2S)-2-acetamido-3-benzoyloxypropanoyl]amino]-3-(4-chlorophenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 10008563) has the molecular formula C27H33ClN6O7 and a molecular weight of 589.05 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-[[(2S)-2-acetamido-3-benzoyloxypropanoyl]amino]-3-(4-chlorophenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[[(2R)-2-[[(2S)-2-acetamido-3-benzoyloxypropanoyl]amino]-3-(4-chlorophenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 10008563 |
| Molecular Formula | C27H33ClN6O7 |
| Molecular Weight | 589.05 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | (2S)-2-[[(2R)-2-[[(2S)-2-acetamido-3-benzoyloxypropanoyl]amino]-3-(4-chlorophenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(=O)N[C@@H](COC(=O)c1ccccc1)C(=O)N[C@H](Cc1ccc(Cl)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C27H33ClN6O7/c1-16(35)32-22(15-41-26(40)18-6-3-2-4-7-18)24(37)34-21(14-17-9-11-19(28)12-10-17)23(36)33-20(25(38)39)8-5-13-31-27(29)30/h2-4,6-7,9-12,20-22H,5,8,13-15H2,1H3,(H,32,35)(H,33,36)(H,34,37)(H,38,39)(H4,29,30,31)/t20-,21+,22-/m0/s1 |
| InChIKey | KNCDHARUVQQKQA-BDTNDASRSA-N |
| XLogP | 0.35 |
| TPSA | 215.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.05 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|