C32H55FO5SSi2 — CID 10009137
[(1R,5R,6R)-2-[[(E)-2-(benzenesulfinyl)-1-ethoxyethenoxy]methyl]-5-[tert-butyl(dimethyl)silyl]oxy-6-(3-fluoropropyl)cyclohex-2-en-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10009137) has the molecular formula C32H55FO5SSi2 and a molecular weight of 627.02 g/mol. Its IUPAC name is [(1R,5R,6R)-2-[[(E)-2-(benzenesulfinyl)-1-ethoxyethenoxy]methyl]-5-[tert-butyl(dimethyl)silyl]oxy-6-(3-fluoropropyl)cyclohex-2-en-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,5R,6R)-2-[[(E)-2-(benzenesulfinyl)-1-ethoxyethenoxy]methyl]-5-[tert-butyl(dimethyl)silyl]oxy-6-(3-fluoropropyl)cyclohex-2-en-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10009137 |
| Molecular Formula | C32H55FO5SSi2 |
| Molecular Weight | 627.02 g/mol |
| Exact Mass | 626.33 |
| IUPAC Name | [(1R,5R,6R)-2-[[(E)-2-(benzenesulfinyl)-1-ethoxyethenoxy]methyl]-5-[tert-butyl(dimethyl)silyl]oxy-6-(3-fluoropropyl)cyclohex-2-en-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CCO/C(=C\S(=O)c1ccccc1)OCC1=CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CCCF)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H55FO5SSi2/c1-12-35-29(24-39(34)26-17-14-13-15-18-26)36-23-25-20-21-28(37-40(8,9)31(2,3)4)27(19-16-22-33)30(25)38-41(10,11)32(5,6)7/h13-15,17-18,20,24,27-28,30H,12,16,19,21-23H2,1-11H3/b29-24+/t27-,28-,30+,39?/m1/s1 |
| InChIKey | RTECOBAYNCPCOW-MWGVRPPXSA-N |
| XLogP | 9.12 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.02 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|