C31H58O5SSi2 — CID 11966453
[(E,2R,5S,7S)-10-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2,8-dimethyldec-8-enoxy]-triethylsilane (PubChem CID 11966453) has the molecular formula C31H58O5SSi2 and a molecular weight of 599.04 g/mol. Its IUPAC name is [(E,2R,5S,7S)-10-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2,8-dimethyldec-8-enoxy]-triethylsilane.
| Compound Name | [(E,2R,5S,7S)-10-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2,8-dimethyldec-8-enoxy]-triethylsilane |
|---|---|
| PubChem CID | 11966453 |
| Molecular Formula | C31H58O5SSi2 |
| Molecular Weight | 599.04 g/mol |
| Exact Mass | 598.35 |
| IUPAC Name | [(E,2R,5S,7S)-10-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2,8-dimethyldec-8-enoxy]-triethylsilane |
| SMILES | CC[Si](CC)(CC)OC[C@H](C)CC[C@@H](C[C@H](OC)/C(C)=C/CS(=O)(=O)c1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H58O5SSi2/c1-12-39(13-2,14-3)35-25-26(4)20-21-28(36-38(10,11)31(6,7)8)24-30(34-9)27(5)22-23-37(32,33)29-18-16-15-17-19-29/h15-19,22,26,28,30H,12-14,20-21,23-25H2,1-11H3/b27-22+/t26-,28+,30+/m1/s1 |
| InChIKey | ALZFASBGUDYGAK-RUUUNSCRSA-N |
| XLogP | 8.64 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.04 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|