C7H8N4OS — CID 10012901
4-methyl-3-(5-methyl-1,3-oxazol-4-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 10012901) has the molecular formula C7H8N4OS and a molecular weight of 196.23 g/mol. Its IUPAC name is 4-methyl-3-(5-methyl-1,3-oxazol-4-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-methyl-3-(5-methyl-1,3-oxazol-4-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 10012901 |
| Molecular Formula | C7H8N4OS |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 4-methyl-3-(5-methyl-1,3-oxazol-4-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1ocnc1-c1n[nH]c(=S)n1C |
| InChI | InChI=1S/C7H8N4OS/c1-4-5(8-3-12-4)6-9-10-7(13)11(6)2/h3H,1-2H3,(H,10,13) |
| InChIKey | CWIPSXKHTYFIOU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|