C6H13N3S — CID 143798794
3,4-dimethyl-1H-1,2,4-triazole-5-thione;ethane (PubChem CID 143798794) has the molecular formula C6H13N3S and a molecular weight of 159.26 g/mol. Its IUPAC name is 3,4-dimethyl-1H-1,2,4-triazole-5-thione;ethane.
| Compound Name | 3,4-dimethyl-1H-1,2,4-triazole-5-thione;ethane |
|---|---|
| PubChem CID | 143798794 |
| Molecular Formula | C6H13N3S |
| Molecular Weight | 159.26 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 3,4-dimethyl-1H-1,2,4-triazole-5-thione;ethane |
| SMILES | CC.Cc1n[nH]c(=S)n1C |
| InChI | InChI=1S/C4H7N3S.C2H6/c1-3-5-6-4(8)7(3)2;1-2/h1-2H3,(H,6,8);1-2H3 |
| InChIKey | FMXXBUVTWSRVDA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|