C7H14N4S — CID 43645496
4-methyl-3-[methyl(propan-2-yl)amino]-1H-1,2,4-triazole-5-thione (PubChem CID 43645496) has the molecular formula C7H14N4S and a molecular weight of 186.28 g/mol. Its IUPAC name is 4-methyl-3-[methyl(propan-2-yl)amino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-methyl-3-[methyl(propan-2-yl)amino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 43645496 |
| Molecular Formula | C7H14N4S |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 4-methyl-3-[methyl(propan-2-yl)amino]-1H-1,2,4-triazole-5-thione |
| SMILES | CC(C)N(C)c1n[nH]c(=S)n1C |
| InChI | InChI=1S/C7H14N4S/c1-5(2)10(3)6-8-9-7(12)11(6)4/h5H,1-4H3,(H,9,12) |
| InChIKey | HWEVUTZXUVGRKV-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|