C10H20N4S2 — CID 112663347
3-[methyl(1-methylsulfanylpropan-2-yl)amino]-4-propan-2-yl-1H-1,2,4-triazole-5-thione (PubChem CID 112663347) has the molecular formula C10H20N4S2 and a molecular weight of 260.43 g/mol. Its IUPAC name is 3-[methyl(1-methylsulfanylpropan-2-yl)amino]-4-propan-2-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[methyl(1-methylsulfanylpropan-2-yl)amino]-4-propan-2-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 112663347 |
| Molecular Formula | C10H20N4S2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 3-[methyl(1-methylsulfanylpropan-2-yl)amino]-4-propan-2-yl-1H-1,2,4-triazole-5-thione |
| SMILES | CSCC(C)N(C)c1n[nH]c(=S)n1C(C)C |
| InChI | InChI=1S/C10H20N4S2/c1-7(2)14-9(11-12-10(14)15)13(4)8(3)6-16-5/h7-8H,6H2,1-5H3,(H,12,15) |
| InChIKey | AGMPRWWONZTTLM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|