C5H7F2N3S — CID 115407727
4-(2,2-difluoroethyl)-3-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 115407727) has the molecular formula C5H7F2N3S and a molecular weight of 179.20 g/mol. Its IUPAC name is 4-(2,2-difluoroethyl)-3-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(2,2-difluoroethyl)-3-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 115407727 |
| Molecular Formula | C5H7F2N3S |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.03 |
| IUPAC Name | 4-(2,2-difluoroethyl)-3-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1n[nH]c(=S)n1CC(F)F |
| InChI | InChI=1S/C5H7F2N3S/c1-3-8-9-5(11)10(3)2-4(6)7/h4H,2H2,1H3,(H,9,11) |
| InChIKey | VICLBWSGUPIGGV-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|