C13H16O3 — CID 10013804
[(2R)-3,4-dideuterio-5-oxohexan-2-yl] benzoate (PubChem CID 10013804) has the molecular formula C13H16O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is [(2R)-3,4-dideuterio-5-oxohexan-2-yl] benzoate.
| Compound Name | [(2R)-3,4-dideuterio-5-oxohexan-2-yl] benzoate |
|---|---|
| PubChem CID | 10013804 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | [(2R)-3,4-dideuterio-5-oxohexan-2-yl] benzoate |
| SMILES | [2H]C(C(C)=O)C([2H])[C@@H](C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H16O3/c1-10(14)8-9-11(2)16-13(15)12-6-4-3-5-7-12/h3-7,11H,8-9H2,1-2H3/t11-/m1/s1/i8D,9D/t8?,9?,11- |
| InChIKey | XEYHBFFMDNLBAU-GUOYZNMPSA-N |
| XLogP | 2.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |