C13H16ClNO — CID 10014404
trans-(1R,2R)-2-[(3-chlorophenyl)methylideneamino]cyclohexan-1-ol (PubChem CID 10014404) has the molecular formula C13H16ClNO and a molecular weight of 237.73 g/mol. Its IUPAC name is trans-(1R,2R)-2-[(3-chlorophenyl)methylideneamino]cyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-2-[(3-chlorophenyl)methylideneamino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 10014404 |
| Molecular Formula | C13H16ClNO |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | trans-(1R,2R)-2-[(3-chlorophenyl)methylideneamino]cyclohexan-1-ol |
| SMILES | O[C@@H]1CCCC[C@H]1/N=C/c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H16ClNO/c14-11-5-3-4-10(8-11)9-15-12-6-1-2-7-13(12)16/h3-5,8-9,12-13,16H,1-2,6-7H2/b15-9+/t12-,13-/m1/s1 |
| InChIKey | WJVVGDRIBBFXJL-SICXBXQRSA-N |
| XLogP | 3.06 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|