C15H13Cl2NO — CID 11197151
(2S)-2-[(3,5-dichlorophenyl)methylideneamino]-2-phenylethanol (PubChem CID 11197151) has the molecular formula C15H13Cl2NO and a molecular weight of 294.18 g/mol. Its IUPAC name is (2S)-2-[(3,5-dichlorophenyl)methylideneamino]-2-phenylethanol.
| Compound Name | (2S)-2-[(3,5-dichlorophenyl)methylideneamino]-2-phenylethanol |
|---|---|
| PubChem CID | 11197151 |
| Molecular Formula | C15H13Cl2NO |
| Molecular Weight | 294.18 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | (2S)-2-[(3,5-dichlorophenyl)methylideneamino]-2-phenylethanol |
| SMILES | OC[C@@H](/N=C/c1cc(Cl)cc(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C15H13Cl2NO/c16-13-6-11(7-14(17)8-13)9-18-15(10-19)12-4-2-1-3-5-12/h1-9,15,19H,10H2/b18-9+/t15-/m1/s1 |
| InChIKey | HLQRVEOEZZOVGO-QANDDYDISA-N |
| XLogP | 4.15 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.18 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|