C16H32OSi — CID 10015875
1-[(1R,3R)-3-tri(propan-2-yl)silylcyclopentyl]ethanone (PubChem CID 10015875) has the molecular formula C16H32OSi and a molecular weight of 268.52 g/mol. Its IUPAC name is 1-[(1R,3R)-3-tri(propan-2-yl)silylcyclopentyl]ethanone.
| Compound Name | 1-[(1R,3R)-3-tri(propan-2-yl)silylcyclopentyl]ethanone |
|---|---|
| PubChem CID | 10015875 |
| Molecular Formula | C16H32OSi |
| Molecular Weight | 268.52 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 1-[(1R,3R)-3-tri(propan-2-yl)silylcyclopentyl]ethanone |
| SMILES | CC(=O)[C@@H]1CC[C@@H]([Si](C(C)C)(C(C)C)C(C)C)C1 |
| InChI | InChI=1S/C16H32OSi/c1-11(2)18(12(3)4,13(5)6)16-9-8-15(10-16)14(7)17/h11-13,15-16H,8-10H2,1-7H3/t15-,16-/m1/s1 |
| InChIKey | YMNYKXDBIZZNJI-HZPDHXFCSA-N |
| XLogP | 5.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.52 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|