C14H27FOSi — CID 10658901
1-[(1R,3R)-3-[fluoro-di(propan-2-yl)silyl]-1-methylcyclopentyl]ethanone (PubChem CID 10658901) has the molecular formula C14H27FOSi and a molecular weight of 258.45 g/mol. Its IUPAC name is 1-[(1R,3R)-3-[fluoro-di(propan-2-yl)silyl]-1-methylcyclopentyl]ethanone.
| Compound Name | 1-[(1R,3R)-3-[fluoro-di(propan-2-yl)silyl]-1-methylcyclopentyl]ethanone |
|---|---|
| PubChem CID | 10658901 |
| Molecular Formula | C14H27FOSi |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 1-[(1R,3R)-3-[fluoro-di(propan-2-yl)silyl]-1-methylcyclopentyl]ethanone |
| SMILES | CC(=O)[C@]1(C)CC[C@@H]([Si](F)(C(C)C)C(C)C)C1 |
| InChI | InChI=1S/C14H27FOSi/c1-10(2)17(15,11(3)4)13-7-8-14(6,9-13)12(5)16/h10-11,13H,7-9H2,1-6H3/t13-,14-/m1/s1 |
| InChIKey | YFXPXKIFXULKAB-ZIAGYGMSSA-N |
| XLogP | 4.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|