C17H31FOSi — CID 10851665
(3R,5R)-3-[fluoro-di(propan-2-yl)silyl]spiro[4.6]undecan-11-one (PubChem CID 10851665) has the molecular formula C17H31FOSi and a molecular weight of 298.52 g/mol. Its IUPAC name is (3R,5R)-3-[fluoro-di(propan-2-yl)silyl]spiro[4.6]undecan-11-one.
| Compound Name | (3R,5R)-3-[fluoro-di(propan-2-yl)silyl]spiro[4.6]undecan-11-one |
|---|---|
| PubChem CID | 10851665 |
| Molecular Formula | C17H31FOSi |
| Molecular Weight | 298.52 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | (3R,5R)-3-[fluoro-di(propan-2-yl)silyl]spiro[4.6]undecan-11-one |
| SMILES | CC(C)[Si](F)(C(C)C)[C@@H]1CC[C@]2(CCCCCC2=O)C1 |
| InChI | InChI=1S/C17H31FOSi/c1-13(2)20(18,14(3)4)15-9-11-17(12-15)10-7-5-6-8-16(17)19/h13-15H,5-12H2,1-4H3/t15-,17-/m1/s1 |
| InChIKey | CPHDPZFUULGMIH-NVXWUHKLSA-N |
| XLogP | 5.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.52 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|