C18H33FOSi — CID 10805099
(3R,5R)-3-[fluoro-di(propan-2-yl)silyl]spiro[4.7]dodecan-12-one (PubChem CID 10805099) has the molecular formula C18H33FOSi and a molecular weight of 312.55 g/mol. Its IUPAC name is (3R,5R)-3-[fluoro-di(propan-2-yl)silyl]spiro[4.7]dodecan-12-one.
| Compound Name | (3R,5R)-3-[fluoro-di(propan-2-yl)silyl]spiro[4.7]dodecan-12-one |
|---|---|
| PubChem CID | 10805099 |
| Molecular Formula | C18H33FOSi |
| Molecular Weight | 312.55 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | (3R,5R)-3-[fluoro-di(propan-2-yl)silyl]spiro[4.7]dodecan-12-one |
| SMILES | CC(C)[Si](F)(C(C)C)[C@@H]1CC[C@]2(CCCCCCC2=O)C1 |
| InChI | InChI=1S/C18H33FOSi/c1-14(2)21(19,15(3)4)16-10-12-18(13-16)11-8-6-5-7-9-17(18)20/h14-16H,5-13H2,1-4H3/t16-,18-/m1/s1 |
| InChIKey | VRYWXRWVZNYNIT-SJLPKXTDSA-N |
| XLogP | 6.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.55 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|