C13H25FOSi — CID 10847914
1-[(1R,3R)-3-[fluoro(dimethyl)silyl]cyclopentyl]-3,3-dimethylbutan-1-one (PubChem CID 10847914) has the molecular formula C13H25FOSi and a molecular weight of 244.43 g/mol. Its IUPAC name is 1-[(1R,3R)-3-[fluoro(dimethyl)silyl]cyclopentyl]-3,3-dimethylbutan-1-one.
| Compound Name | 1-[(1R,3R)-3-[fluoro(dimethyl)silyl]cyclopentyl]-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 10847914 |
| Molecular Formula | C13H25FOSi |
| Molecular Weight | 244.43 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 1-[(1R,3R)-3-[fluoro(dimethyl)silyl]cyclopentyl]-3,3-dimethylbutan-1-one |
| SMILES | CC(C)(C)CC(=O)[C@@H]1CC[C@@H]([Si](C)(C)F)C1 |
| InChI | InChI=1S/C13H25FOSi/c1-13(2,3)9-12(15)10-6-7-11(8-10)16(4,5)14/h10-11H,6-9H2,1-5H3/t10-,11-/m1/s1 |
| InChIKey | OIOSLENVUPGGDZ-GHMZBOCLSA-N |
| XLogP | 4.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|