C13H23FOSi — CID 10562164
cyclopentyl-[(1R,3R)-3-[fluoro(dimethyl)silyl]cyclopentyl]methanone (PubChem CID 10562164) has the molecular formula C13H23FOSi and a molecular weight of 242.41 g/mol. Its IUPAC name is cyclopentyl-[(1R,3R)-3-[fluoro(dimethyl)silyl]cyclopentyl]methanone.
| Compound Name | cyclopentyl-[(1R,3R)-3-[fluoro(dimethyl)silyl]cyclopentyl]methanone |
|---|---|
| PubChem CID | 10562164 |
| Molecular Formula | C13H23FOSi |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | cyclopentyl-[(1R,3R)-3-[fluoro(dimethyl)silyl]cyclopentyl]methanone |
| SMILES | C[Si](C)(F)[C@@H]1CC[C@@H](C(=O)C2CCCC2)C1 |
| InChI | InChI=1S/C13H23FOSi/c1-16(2,14)12-8-7-11(9-12)13(15)10-5-3-4-6-10/h10-12H,3-9H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | TYEVDMYROLICMP-VXGBXAGGSA-N |
| XLogP | 4.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|