C21H40OSi — CID 100977687
1-[(2R,3aS,8aS)-2-tri(propan-2-yl)silyl-2,3,4,5,6,7,8,8a-octahydro-1H-azulen-3a-yl]ethanone (PubChem CID 100977687) has the molecular formula C21H40OSi and a molecular weight of 336.64 g/mol. Its IUPAC name is 1-[(2R,3aS,8aS)-2-tri(propan-2-yl)silyl-2,3,4,5,6,7,8,8a-octahydro-1H-azulen-3a-yl]ethanone.
| Compound Name | 1-[(2R,3aS,8aS)-2-tri(propan-2-yl)silyl-2,3,4,5,6,7,8,8a-octahydro-1H-azulen-3a-yl]ethanone |
|---|---|
| PubChem CID | 100977687 |
| Molecular Formula | C21H40OSi |
| Molecular Weight | 336.64 g/mol |
| Exact Mass | 336.28 |
| IUPAC Name | 1-[(2R,3aS,8aS)-2-tri(propan-2-yl)silyl-2,3,4,5,6,7,8,8a-octahydro-1H-azulen-3a-yl]ethanone |
| SMILES | CC(=O)[C@]12CCCCC[C@H]1C[C@@H]([Si](C(C)C)(C(C)C)C(C)C)C2 |
| InChI | InChI=1S/C21H40OSi/c1-15(2)23(16(3)4,17(5)6)20-13-19-11-9-8-10-12-21(19,14-20)18(7)22/h15-17,19-20H,8-14H2,1-7H3/t19-,20+,21+/m0/s1 |
| InChIKey | ILTGXULQDCLQKK-PWRODBHTSA-N |
| XLogP | 6.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.64 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|