C12H23FOSi — CID 10466416
3-[[fluoro(dimethyl)silyl]methyl]-3,5,5-trimethylcyclohexan-1-one (PubChem CID 10466416) has the molecular formula C12H23FOSi and a molecular weight of 230.40 g/mol. Its IUPAC name is 3-[[fluoro(dimethyl)silyl]methyl]-3,5,5-trimethylcyclohexan-1-one.
| Compound Name | 3-[[fluoro(dimethyl)silyl]methyl]-3,5,5-trimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 10466416 |
| Molecular Formula | C12H23FOSi |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 3-[[fluoro(dimethyl)silyl]methyl]-3,5,5-trimethylcyclohexan-1-one |
| SMILES | CC1(C)CC(=O)CC(C)(C[Si](C)(C)F)C1 |
| InChI | InChI=1S/C12H23FOSi/c1-11(2)6-10(14)7-12(3,8-11)9-15(4,5)13/h6-9H2,1-5H3 |
| InChIKey | CXVBTODGPFZJNS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|