C20H40OSi — CID 139263738
3-[dimethyl(2,3,3,4-tetramethylpentan-2-yl)silyl]-3,5,5-trimethylcyclohexan-1-one (PubChem CID 139263738) has the molecular formula C20H40OSi and a molecular weight of 324.63 g/mol. Its IUPAC name is 3-[dimethyl(2,3,3,4-tetramethylpentan-2-yl)silyl]-3,5,5-trimethylcyclohexan-1-one.
| Compound Name | 3-[dimethyl(2,3,3,4-tetramethylpentan-2-yl)silyl]-3,5,5-trimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 139263738 |
| Molecular Formula | C20H40OSi |
| Molecular Weight | 324.63 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | 3-[dimethyl(2,3,3,4-tetramethylpentan-2-yl)silyl]-3,5,5-trimethylcyclohexan-1-one |
| SMILES | CC(C)C(C)(C)C(C)(C)[Si](C)(C)C1(C)CC(=O)CC(C)(C)C1 |
| InChI | InChI=1S/C20H40OSi/c1-15(2)18(5,6)19(7,8)22(10,11)20(9)13-16(21)12-17(3,4)14-20/h15H,12-14H2,1-11H3 |
| InChIKey | BFRFYRRFIXUAPX-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.63 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|