About (5-methyl-2-propan-2-ylcyclohexyl) morpholine-4-carboxylate
(5-methyl-2-propan-2-ylcyclohexyl) morpholine-4-carboxylate (PubChem CID 10015916) has the molecular formula C15H27NO3
and a molecular weight of 269.38 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) morpholine-4-carboxylate.
Molecular Properties
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) morpholine-4-carboxylate |
| PubChem CID | 10015916 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) morpholine-4-carboxylate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)N2CCOCC2)C1 |
| InChI | InChI=1S/C15H27NO3/c1-11(2)13-5-4-12(3)10-14(13)19-15(17)16-6-8-18-9-7-16/h11-14H,4-10H2,1-3H3 |
| InChIKey | OSMGKYGOMMKPIY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-methyl-2-propan-2-ylcyclohexyl) morpholine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-2-propan-2-ylcyclohexyl) morpholine-4-carboxylate?
The IUPAC name of (5-methyl-2-propan-2-ylcyclohexyl) morpholine-4-carboxylate (CID 10015916) is (5-methyl-2-propan-2-ylcyclohexyl) morpholine-4-carboxylate.
What is the SMILES notation for (5-methyl-2-propan-2-ylcyclohexyl) morpholine-4-carboxylate?
The canonical SMILES for (5-methyl-2-propan-2-ylcyclohexyl) morpholine-4-carboxylate is CC1CCC(C(C)C)C(OC(=O)N2CCOCC2)C1.
What is the InChIKey of (5-methyl-2-propan-2-ylcyclohexyl) morpholine-4-carboxylate?
The InChIKey is OSMGKYGOMMKPIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO3/c1-11(2)13-5-4-12(3)10-14(13)19-15(17)16-6-8-18-9-7-16/h11-14H,4-10H2,1-3H3.
What are the key properties of (5-methyl-2-propan-2-ylcyclohexyl) morpholine-4-carboxylate?
(5-methyl-2-propan-2-ylcyclohexyl) morpholine-4-carboxylate has a molecular weight of 269.38 g/mol, XLogP of 2.92, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-2-propan-2-ylcyclohexyl) morpholine-4-carboxylate is sourced from PubChem (CID 10015916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).