C16H27NO4 — CID 25196299
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-morpholin-4-yl-2-oxoacetate (PubChem CID 25196299) has the molecular formula C16H27NO4 and a molecular weight of 297.40 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-morpholin-4-yl-2-oxoacetate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-morpholin-4-yl-2-oxoacetate |
|---|---|
| PubChem CID | 25196299 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-morpholin-4-yl-2-oxoacetate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C16H27NO4/c1-11(2)13-5-4-12(3)10-14(13)21-16(19)15(18)17-6-8-20-9-7-17/h11-14H,4-10H2,1-3H3/t12-,13+,14-/m1/s1 |
| InChIKey | DQUMXIWYFHUENX-HZSPNIEDSA-N |
| XLogP | 1.85 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|