C15H22O5 — CID 10016622
methyl (2E)-3-[2-[(6-methoxy-3,4-dihydro-2H-pyran-4-yl)oxy]propan-2-yl]penta-2,4-dienoate (PubChem CID 10016622) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is methyl (2E)-3-[2-[(6-methoxy-3,4-dihydro-2H-pyran-4-yl)oxy]propan-2-yl]penta-2,4-dienoate.
| Compound Name | methyl (2E)-3-[2-[(6-methoxy-3,4-dihydro-2H-pyran-4-yl)oxy]propan-2-yl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 10016622 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | methyl (2E)-3-[2-[(6-methoxy-3,4-dihydro-2H-pyran-4-yl)oxy]propan-2-yl]penta-2,4-dienoate |
| SMILES | C=C/C(=C\C(=O)OC)C(C)(C)OC1C=C(OC)OCC1 |
| InChI | InChI=1S/C15H22O5/c1-6-11(9-13(16)17-4)15(2,3)20-12-7-8-19-14(10-12)18-5/h6,9-10,12H,1,7-8H2,2-5H3/b11-9+ |
| InChIKey | MIJDKNCYNYWHFS-PKNBQFBNSA-N |
| XLogP | 2.34 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|