C15H18O5 — CID 139588349
methyl (E)-3-[(7aR)-3-methoxy-2,6-dimethyl-7aH-furo[2,3-b]pyran-4-yl]but-2-enoate (PubChem CID 139588349) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is methyl (E)-3-[(7aR)-3-methoxy-2,6-dimethyl-7aH-furo[2,3-b]pyran-4-yl]but-2-enoate.
| Compound Name | methyl (E)-3-[(7aR)-3-methoxy-2,6-dimethyl-7aH-furo[2,3-b]pyran-4-yl]but-2-enoate |
|---|---|
| PubChem CID | 139588349 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | methyl (E)-3-[(7aR)-3-methoxy-2,6-dimethyl-7aH-furo[2,3-b]pyran-4-yl]but-2-enoate |
| SMILES | COC(=O)/C=C(\C)C1=C2C(OC)=C(C)O[C@H]2OC(C)=C1 |
| InChI | InChI=1S/C15H18O5/c1-8(6-12(16)17-4)11-7-9(2)19-15-13(11)14(18-5)10(3)20-15/h6-7,15H,1-5H3/b8-6+/t15-/m1/s1 |
| InChIKey | ZFLGIXPPHIPBBJ-PMGBHYCQSA-N |
| XLogP | 2.57 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|