C8H8O4 — CID 14356658
(4S)-4-methoxy-4,6-dihydrofuro[3,2-c]pyran-2-one (PubChem CID 14356658) has the molecular formula C8H8O4 and a molecular weight of 168.15 g/mol. Its IUPAC name is (4S)-4-methoxy-4,6-dihydrofuro[3,2-c]pyran-2-one.
| Compound Name | (4S)-4-methoxy-4,6-dihydrofuro[3,2-c]pyran-2-one |
|---|---|
| PubChem CID | 14356658 |
| Molecular Formula | C8H8O4 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | (4S)-4-methoxy-4,6-dihydrofuro[3,2-c]pyran-2-one |
| SMILES | CO[C@H]1OCC=C2OC(=O)C=C21 |
| InChI | InChI=1S/C8H8O4/c1-10-8-5-4-7(9)12-6(5)2-3-11-8/h2,4,8H,3H2,1H3/t8-/m0/s1 |
| InChIKey | VPGCSEQPAOOVGQ-QMMMGPOBSA-N |
| XLogP | 0.36 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |