C17H18N2O2 — CID 10016631
4-methyl-N-[2-[(7-oxocyclohepta-1,3,5-trien-1-yl)amino]ethyl]benzamide (PubChem CID 10016631) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 4-methyl-N-[2-[(7-oxocyclohepta-1,3,5-trien-1-yl)amino]ethyl]benzamide.
| Compound Name | 4-methyl-N-[2-[(7-oxocyclohepta-1,3,5-trien-1-yl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 10016631 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 4-methyl-N-[2-[(7-oxocyclohepta-1,3,5-trien-1-yl)amino]ethyl]benzamide |
| SMILES | Cc1ccc(C(=O)NCCNc2cccccc2=O)cc1 |
| InChI | InChI=1S/C17H18N2O2/c1-13-7-9-14(10-8-13)17(21)19-12-11-18-15-5-3-2-4-6-16(15)20/h2-10H,11-12H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | NNORWRVWFVAYTC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|