C16H9F2N3O — CID 10017510
9-fluoro-2-(2-fluorophenyl)-1H-pyrazolo[4,3-c]quinolin-3-one (PubChem CID 10017510) has the molecular formula C16H9F2N3O and a molecular weight of 297.26 g/mol. Its IUPAC name is 9-fluoro-2-(2-fluorophenyl)-1H-pyrazolo[4,3-c]quinolin-3-one.
| Compound Name | 9-fluoro-2-(2-fluorophenyl)-1H-pyrazolo[4,3-c]quinolin-3-one |
|---|---|
| PubChem CID | 10017510 |
| Molecular Formula | C16H9F2N3O |
| Molecular Weight | 297.26 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 9-fluoro-2-(2-fluorophenyl)-1H-pyrazolo[4,3-c]quinolin-3-one |
| SMILES | O=c1c2cnc3cccc(F)c3c2[nH]n1-c1ccccc1F |
| InChI | InChI=1S/C16H9F2N3O/c17-10-4-1-2-7-13(10)21-16(22)9-8-19-12-6-3-5-11(18)14(12)15(9)20-21/h1-8,20H |
| InChIKey | JBLIPVBOXSMCAJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|