C17H15FN2O3 — CID 10018501
2-[6-[(4-fluorophenyl)methoxy]-3-oxo-1H-isoindol-2-yl]acetamide (PubChem CID 10018501) has the molecular formula C17H15FN2O3 and a molecular weight of 314.32 g/mol. Its IUPAC name is 2-[6-[(4-fluorophenyl)methoxy]-3-oxo-1H-isoindol-2-yl]acetamide.
| Compound Name | 2-[6-[(4-fluorophenyl)methoxy]-3-oxo-1H-isoindol-2-yl]acetamide |
|---|---|
| PubChem CID | 10018501 |
| Molecular Formula | C17H15FN2O3 |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 2-[6-[(4-fluorophenyl)methoxy]-3-oxo-1H-isoindol-2-yl]acetamide |
| SMILES | NC(=O)CN1Cc2cc(OCc3ccc(F)cc3)ccc2C1=O |
| InChI | InChI=1S/C17H15FN2O3/c18-13-3-1-11(2-4-13)10-23-14-5-6-15-12(7-14)8-20(17(15)22)9-16(19)21/h1-7H,8-10H2,(H2,19,21) |
| InChIKey | MXYSDGRHJQHSAV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |