C18H15FN2O5 — CID 22397104
2-[5-[(4-fluorophenyl)methoxy]-1,3-dioxoisoindol-2-yl]-3-hydroxypropanamide (PubChem CID 22397104) has the molecular formula C18H15FN2O5 and a molecular weight of 358.33 g/mol. Its IUPAC name is 2-[5-[(4-fluorophenyl)methoxy]-1,3-dioxoisoindol-2-yl]-3-hydroxypropanamide.
| Compound Name | 2-[5-[(4-fluorophenyl)methoxy]-1,3-dioxoisoindol-2-yl]-3-hydroxypropanamide |
|---|---|
| PubChem CID | 22397104 |
| Molecular Formula | C18H15FN2O5 |
| Molecular Weight | 358.33 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 2-[5-[(4-fluorophenyl)methoxy]-1,3-dioxoisoindol-2-yl]-3-hydroxypropanamide |
| SMILES | NC(=O)C(CO)N1C(=O)c2ccc(OCc3ccc(F)cc3)cc2C1=O |
| InChI | InChI=1S/C18H15FN2O5/c19-11-3-1-10(2-4-11)9-26-12-5-6-13-14(7-12)18(25)21(17(13)24)15(8-22)16(20)23/h1-7,15,22H,8-9H2,(H2,20,23) |
| InChIKey | OLIHQYOFKLBFKB-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.33 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|