C22H28Si — CID 10018944
[(3,3-dimethylcyclopenten-1-yl)-phenylmethyl]-dimethyl-phenylsilane (PubChem CID 10018944) has the molecular formula C22H28Si and a molecular weight of 320.55 g/mol. Its IUPAC name is [(3,3-dimethylcyclopenten-1-yl)-phenylmethyl]-dimethyl-phenylsilane.
| Compound Name | [(3,3-dimethylcyclopenten-1-yl)-phenylmethyl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 10018944 |
| Molecular Formula | C22H28Si |
| Molecular Weight | 320.55 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | [(3,3-dimethylcyclopenten-1-yl)-phenylmethyl]-dimethyl-phenylsilane |
| SMILES | CC1(C)C=C(C(c2ccccc2)[Si](C)(C)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H28Si/c1-22(2)16-15-19(17-22)21(18-11-7-5-8-12-18)23(3,4)20-13-9-6-10-14-20/h5-14,17,21H,15-16H2,1-4H3 |
| InChIKey | VKMSIVNYRDVFDT-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.55 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|