About (4-sulfamoylanilino) morpholine-4-carbodithioate
(4-sulfamoylanilino) morpholine-4-carbodithioate (PubChem CID 10019750) has the molecular formula C11H15N3O3S3
and a molecular weight of 333.46 g/mol. Its IUPAC name is (4-sulfamoylanilino) morpholine-4-carbodithioate.
Molecular Properties
| Compound Name | (4-sulfamoylanilino) morpholine-4-carbodithioate |
| PubChem CID | 10019750 |
| Molecular Formula | C11H15N3O3S3 |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | (4-sulfamoylanilino) morpholine-4-carbodithioate |
| SMILES | NS(=O)(=O)c1ccc(NSC(=S)N2CCOCC2)cc1 |
| InChI | InChI=1S/C11H15N3O3S3/c12-20(15,16)10-3-1-9(2-4-10)13-19-11(18)14-5-7-17-8-6-14/h1-4,13H,5-8H2,(H2,12,15,16) |
| InChIKey | DKRVZNFSWMWIPT-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4-sulfamoylanilino) morpholine-4-carbodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-sulfamoylanilino) morpholine-4-carbodithioate?
The IUPAC name of (4-sulfamoylanilino) morpholine-4-carbodithioate (CID 10019750) is (4-sulfamoylanilino) morpholine-4-carbodithioate.
What is the SMILES notation for (4-sulfamoylanilino) morpholine-4-carbodithioate?
The canonical SMILES for (4-sulfamoylanilino) morpholine-4-carbodithioate is NS(=O)(=O)c1ccc(NSC(=S)N2CCOCC2)cc1.
What is the InChIKey of (4-sulfamoylanilino) morpholine-4-carbodithioate?
The InChIKey is DKRVZNFSWMWIPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O3S3/c12-20(15,16)10-3-1-9(2-4-10)13-19-11(18)14-5-7-17-8-6-14/h1-4,13H,5-8H2,(H2,12,15,16).
What are the key properties of (4-sulfamoylanilino) morpholine-4-carbodithioate?
(4-sulfamoylanilino) morpholine-4-carbodithioate has a molecular weight of 333.46 g/mol, XLogP of 1.01, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-sulfamoylanilino) morpholine-4-carbodithioate is sourced from PubChem (CID 10019750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).