C21H37N5O3S2 — CID 5156184
1,1-bis[3-(dimethylamino)propyl]-3-(4-morpholin-4-ylsulfonylphenyl)thiourea (PubChem CID 5156184) has the molecular formula C21H37N5O3S2 and a molecular weight of 471.69 g/mol. Its IUPAC name is 1,1-bis[3-(dimethylamino)propyl]-3-(4-morpholin-4-ylsulfonylphenyl)thiourea.
| Compound Name | 1,1-bis[3-(dimethylamino)propyl]-3-(4-morpholin-4-ylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 5156184 |
| Molecular Formula | C21H37N5O3S2 |
| Molecular Weight | 471.69 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 1,1-bis[3-(dimethylamino)propyl]-3-(4-morpholin-4-ylsulfonylphenyl)thiourea |
| SMILES | CN(C)CCCN(CCCN(C)C)C(=S)Nc1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H37N5O3S2/c1-23(2)11-5-13-25(14-6-12-24(3)4)21(30)22-19-7-9-20(10-8-19)31(27,28)26-15-17-29-18-16-26/h7-10H,5-6,11-18H2,1-4H3,(H,22,30) |
| InChIKey | WHRPCEIJMUDYLN-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.69 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|