C18H27N3O2S2 — CID 2803140
3-methyl-N-(4-piperidin-1-ylsulfonylphenyl)piperidine-1-carbothioamide (PubChem CID 2803140) has the molecular formula C18H27N3O2S2 and a molecular weight of 381.57 g/mol. Its IUPAC name is 3-methyl-N-(4-piperidin-1-ylsulfonylphenyl)piperidine-1-carbothioamide.
| Compound Name | 3-methyl-N-(4-piperidin-1-ylsulfonylphenyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 2803140 |
| Molecular Formula | C18H27N3O2S2 |
| Molecular Weight | 381.57 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 3-methyl-N-(4-piperidin-1-ylsulfonylphenyl)piperidine-1-carbothioamide |
| SMILES | CC1CCCN(C(=S)Nc2ccc(S(=O)(=O)N3CCCCC3)cc2)C1 |
| InChI | InChI=1S/C18H27N3O2S2/c1-15-6-5-11-20(14-15)18(24)19-16-7-9-17(10-8-16)25(22,23)21-12-3-2-4-13-21/h7-10,15H,2-6,11-14H2,1H3,(H,19,24) |
| InChIKey | UDOHVVSSBQPTBY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.57 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|