C12H19N5O2S2 — CID 891831
1-(4-methylpiperazin-1-yl)-3-(4-sulfamoylphenyl)thiourea (PubChem CID 891831) has the molecular formula C12H19N5O2S2 and a molecular weight of 329.45 g/mol. Its IUPAC name is 1-(4-methylpiperazin-1-yl)-3-(4-sulfamoylphenyl)thiourea.
| Compound Name | 1-(4-methylpiperazin-1-yl)-3-(4-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 891831 |
| Molecular Formula | C12H19N5O2S2 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 1-(4-methylpiperazin-1-yl)-3-(4-sulfamoylphenyl)thiourea |
| SMILES | CN1CCN(NC(=S)Nc2ccc(S(N)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C12H19N5O2S2/c1-16-6-8-17(9-7-16)15-12(20)14-10-2-4-11(5-3-10)21(13,18)19/h2-5H,6-9H2,1H3,(H2,13,18,19)(H2,14,15,20) |
| InChIKey | BPPLIZHQOIGRPZ-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|