C22H24O3 — CID 10019913
ethyl (2E,4E)-2-benzyl-3-ethoxy-5-phenylpenta-2,4-dienoate (PubChem CID 10019913) has the molecular formula C22H24O3 and a molecular weight of 336.43 g/mol. Its IUPAC name is ethyl (2E,4E)-2-benzyl-3-ethoxy-5-phenylpenta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-2-benzyl-3-ethoxy-5-phenylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 10019913 |
| Molecular Formula | C22H24O3 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | ethyl (2E,4E)-2-benzyl-3-ethoxy-5-phenylpenta-2,4-dienoate |
| SMILES | CCOC(=O)/C(Cc1ccccc1)=C(\C=C\c1ccccc1)OCC |
| InChI | InChI=1S/C22H24O3/c1-3-24-21(16-15-18-11-7-5-8-12-18)20(22(23)25-4-2)17-19-13-9-6-10-14-19/h5-16H,3-4,17H2,1-2H3/b16-15+,21-20+ |
| InChIKey | NPDKUCWPCCKUGW-YZORZNRUSA-N |
| XLogP | 4.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|