C13H20F3N9 — CID 10021359
1-cyano-2-methyl-3-[4-[3-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]butyl]guanidine (PubChem CID 10021359) has the molecular formula C13H20F3N9 and a molecular weight of 359.36 g/mol. Its IUPAC name is 1-cyano-2-methyl-3-[4-[3-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]butyl]guanidine.
| Compound Name | 1-cyano-2-methyl-3-[4-[3-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]butyl]guanidine |
|---|---|
| PubChem CID | 10021359 |
| Molecular Formula | C13H20F3N9 |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 1-cyano-2-methyl-3-[4-[3-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]butyl]guanidine |
| SMILES | C/N=C(\NC#N)NCCCCn1ccc(N/C(N)=N/CC(F)(F)F)n1 |
| InChI | InChI=1S/C13H20F3N9/c1-19-12(22-9-17)20-5-2-3-6-25-7-4-10(24-25)23-11(18)21-8-13(14,15)16/h4,7H,2-3,5-6,8H2,1H3,(H2,19,20,22)(H3,18,21,23,24) |
| InChIKey | UZQGLYUMAVJAMT-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 128.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|