C10H17F2N3 — CID 75483532
1-(2,2-difluoroethyl)-N-pentan-3-ylpyrazol-3-amine (PubChem CID 75483532) has the molecular formula C10H17F2N3 and a molecular weight of 217.26 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-N-pentan-3-ylpyrazol-3-amine.
| Compound Name | 1-(2,2-difluoroethyl)-N-pentan-3-ylpyrazol-3-amine |
|---|---|
| PubChem CID | 75483532 |
| Molecular Formula | C10H17F2N3 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.14 |
| IUPAC Name | 1-(2,2-difluoroethyl)-N-pentan-3-ylpyrazol-3-amine |
| SMILES | CCC(CC)Nc1ccn(CC(F)F)n1 |
| InChI | InChI=1S/C10H17F2N3/c1-3-8(4-2)13-10-5-6-15(14-10)7-9(11)12/h5-6,8-9H,3-4,7H2,1-2H3,(H,13,14) |
| InChIKey | YUYXTWUXCVSYAN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |