C20H19N3O4 — CID 10021742
4,5-bis(1,3-benzodioxol-5-ylmethyl)-1-methylimidazol-2-amine (PubChem CID 10021742) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is 4,5-bis(1,3-benzodioxol-5-ylmethyl)-1-methylimidazol-2-amine.
| Compound Name | 4,5-bis(1,3-benzodioxol-5-ylmethyl)-1-methylimidazol-2-amine |
|---|---|
| PubChem CID | 10021742 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 4,5-bis(1,3-benzodioxol-5-ylmethyl)-1-methylimidazol-2-amine |
| SMILES | Cn1c(N)nc(Cc2ccc3c(c2)OCO3)c1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H19N3O4/c1-23-15(7-13-3-5-17-19(9-13)27-11-25-17)14(22-20(23)21)6-12-2-4-16-18(8-12)26-10-24-16/h2-5,8-9H,6-7,10-11H2,1H3,(H2,21,22) |
| InChIKey | CHUHMZZQHYOKBF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |