C24H21NO3 — CID 10022111
4-[2-[[2-(9H-fluoren-9-yl)acetyl]amino]ethyl]benzoic acid (PubChem CID 10022111) has the molecular formula C24H21NO3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 4-[2-[[2-(9H-fluoren-9-yl)acetyl]amino]ethyl]benzoic acid.
| Compound Name | 4-[2-[[2-(9H-fluoren-9-yl)acetyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 10022111 |
| Molecular Formula | C24H21NO3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 4-[2-[[2-(9H-fluoren-9-yl)acetyl]amino]ethyl]benzoic acid |
| SMILES | O=C(CC1c2ccccc2-c2ccccc21)NCCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C24H21NO3/c26-23(25-14-13-16-9-11-17(12-10-16)24(27)28)15-22-20-7-3-1-5-18(20)19-6-2-4-8-21(19)22/h1-12,22H,13-15H2,(H,25,26)(H,27,28) |
| InChIKey | KOHFRDBTQYPWDB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |