About 8-methoxy-4-N-methyl-2-N,4-N-bis(2-methylphenyl)quinazoline-2,4-diamine
8-methoxy-4-N-methyl-2-N,4-N-bis(2-methylphenyl)quinazoline-2,4-diamine (PubChem CID 10022914) has the molecular formula C24H24N4O
and a molecular weight of 384.48 g/mol. Its IUPAC name is 8-methoxy-4-N-methyl-2-N,4-N-bis(2-methylphenyl)quinazoline-2,4-diamine.
Molecular Properties
| Compound Name | 8-methoxy-4-N-methyl-2-N,4-N-bis(2-methylphenyl)quinazoline-2,4-diamine |
| PubChem CID | 10022914 |
| Molecular Formula | C24H24N4O |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 8-methoxy-4-N-methyl-2-N,4-N-bis(2-methylphenyl)quinazoline-2,4-diamine |
| SMILES | COc1cccc2c(N(C)c3ccccc3C)nc(Nc3ccccc3C)nc12 |
| InChI | InChI=1S/C24H24N4O/c1-16-10-5-7-13-19(16)25-24-26-22-18(12-9-15-21(22)29-4)23(27-24)28(3)20-14-8-6-11-17(20)2/h5-15H,1-4H3,(H,25,26,27) |
| InChIKey | GWUSQHHPAOUIOD-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-methoxy-4-N-methyl-2-N,4-N-bis(2-methylphenyl)quinazoline-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-4-N-methyl-2-N,4-N-bis(2-methylphenyl)quinazoline-2,4-diamine?
The IUPAC name of 8-methoxy-4-N-methyl-2-N,4-N-bis(2-methylphenyl)quinazoline-2,4-diamine (CID 10022914) is 8-methoxy-4-N-methyl-2-N,4-N-bis(2-methylphenyl)quinazoline-2,4-diamine.
What is the SMILES notation for 8-methoxy-4-N-methyl-2-N,4-N-bis(2-methylphenyl)quinazoline-2,4-diamine?
The canonical SMILES for 8-methoxy-4-N-methyl-2-N,4-N-bis(2-methylphenyl)quinazoline-2,4-diamine is COc1cccc2c(N(C)c3ccccc3C)nc(Nc3ccccc3C)nc12.
What is the InChIKey of 8-methoxy-4-N-methyl-2-N,4-N-bis(2-methylphenyl)quinazoline-2,4-diamine?
The InChIKey is GWUSQHHPAOUIOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N4O/c1-16-10-5-7-13-19(16)25-24-26-22-18(12-9-15-21(22)29-4)23(27-24)28(3)20-14-8-6-11-17(20)2/h5-15H,1-4H3,(H,25,26,27).
What are the key properties of 8-methoxy-4-N-methyl-2-N,4-N-bis(2-methylphenyl)quinazoline-2,4-diamine?
8-methoxy-4-N-methyl-2-N,4-N-bis(2-methylphenyl)quinazoline-2,4-diamine has a molecular weight of 384.48 g/mol, XLogP of 5.77, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-4-N-methyl-2-N,4-N-bis(2-methylphenyl)quinazoline-2,4-diamine is sourced from PubChem (CID 10022914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).