C26H17ClN2O4 — CID 1002331
(4R)-2-amino-4-[2-[(2-chlorophenyl)methoxy]phenyl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile (PubChem CID 1002331) has the molecular formula C26H17ClN2O4 and a molecular weight of 456.89 g/mol. Its IUPAC name is (4R)-2-amino-4-[2-[(2-chlorophenyl)methoxy]phenyl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile.
| Compound Name | (4R)-2-amino-4-[2-[(2-chlorophenyl)methoxy]phenyl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 1002331 |
| Molecular Formula | C26H17ClN2O4 |
| Molecular Weight | 456.89 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | (4R)-2-amino-4-[2-[(2-chlorophenyl)methoxy]phenyl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile |
| SMILES | N#CC1=C(N)Oc2c(c(=O)oc3ccccc23)[C@@H]1c1ccccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C26H17ClN2O4/c27-19-10-4-1-7-15(19)14-31-20-11-5-2-8-16(20)22-18(13-28)25(29)33-24-17-9-3-6-12-21(17)32-26(30)23(22)24/h1-12,22H,14,29H2/t22-/m1/s1 |
| InChIKey | NVGBNPLCVJHZLU-JOCHJYFZSA-N |
| XLogP | 5.24 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.89 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|