C27H34O2 — CID 10023315
(7S,8R,9S,10R,13S,14S)-10,13-dimethyl-7-(2-phenylethyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 10023315) has the molecular formula C27H34O2 and a molecular weight of 390.57 g/mol. Its IUPAC name is (7S,8R,9S,10R,13S,14S)-10,13-dimethyl-7-(2-phenylethyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (7S,8R,9S,10R,13S,14S)-10,13-dimethyl-7-(2-phenylethyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 10023315 |
| Molecular Formula | C27H34O2 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | (7S,8R,9S,10R,13S,14S)-10,13-dimethyl-7-(2-phenylethyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@]12CCC(=O)C=C1C[C@H](CCc1ccccc1)[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C27H34O2/c1-26-14-12-21(28)17-20(26)16-19(9-8-18-6-4-3-5-7-18)25-22-10-11-24(29)27(22,2)15-13-23(25)26/h3-7,17,19,22-23,25H,8-16H2,1-2H3/t19-,22-,23-,25-,26-,27-/m0/s1 |
| InChIKey | WFSMLUZTOHJLKX-HXTWUXIJSA-N |
| XLogP | 5.95 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |