C22H18ClNO4 — CID 10023622
methyl 4-chloro-2-[[2-(3-phenoxyphenyl)acetyl]amino]benzoate (PubChem CID 10023622) has the molecular formula C22H18ClNO4 and a molecular weight of 395.84 g/mol. Its IUPAC name is methyl 4-chloro-2-[[2-(3-phenoxyphenyl)acetyl]amino]benzoate.
| Compound Name | methyl 4-chloro-2-[[2-(3-phenoxyphenyl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 10023622 |
| Molecular Formula | C22H18ClNO4 |
| Molecular Weight | 395.84 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | methyl 4-chloro-2-[[2-(3-phenoxyphenyl)acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)cc1NC(=O)Cc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C22H18ClNO4/c1-27-22(26)19-11-10-16(23)14-20(19)24-21(25)13-15-6-5-9-18(12-15)28-17-7-3-2-4-8-17/h2-12,14H,13H2,1H3,(H,24,25) |
| InChIKey | ZFPNBCOHNZPUTI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.84 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |