C28H23ClN2O5 — CID 20602808
methyl 5-chloro-2-[[2-[6-(4-phenylmethoxyphenoxy)-3-pyridinyl]acetyl]amino]benzoate (PubChem CID 20602808) has the molecular formula C28H23ClN2O5 and a molecular weight of 502.95 g/mol. Its IUPAC name is methyl 5-chloro-2-[[2-[6-(4-phenylmethoxyphenoxy)-3-pyridinyl]acetyl]amino]benzoate.
| Compound Name | methyl 5-chloro-2-[[2-[6-(4-phenylmethoxyphenoxy)-3-pyridinyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 20602808 |
| Molecular Formula | C28H23ClN2O5 |
| Molecular Weight | 502.95 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | methyl 5-chloro-2-[[2-[6-(4-phenylmethoxyphenoxy)-3-pyridinyl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1cc(Cl)ccc1NC(=O)Cc1ccc(Oc2ccc(OCc3ccccc3)cc2)nc1 |
| InChI | InChI=1S/C28H23ClN2O5/c1-34-28(33)24-16-21(29)8-13-25(24)31-26(32)15-20-7-14-27(30-17-20)36-23-11-9-22(10-12-23)35-18-19-5-3-2-4-6-19/h2-14,16-17H,15,18H2,1H3,(H,31,32) |
| InChIKey | MEVNELVTIAUIRV-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.95 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |